C11H8ClNO4 — CID 792345
2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoic acid (PubChem CID 792345) has the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoic acid.
| Compound Name | 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 792345 |
| Molecular Formula | C11H8ClNO4 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)CCC2=O)ccc1Cl |
| InChI | InChI=1S/C11H8ClNO4/c12-8-2-1-6(5-7(8)11(16)17)13-9(14)3-4-10(13)15/h1-2,5H,3-4H2,(H,16,17) |
| InChIKey | VNFPUIQFBSACFO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|