C15H11NO5 — CID 98070646
3-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoic acid (PubChem CID 98070646) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 98070646 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3O2)c1 |
| InChI | InChI=1S/C15H11NO5/c17-13-11-9-4-5-10(21-9)12(11)14(18)16(13)8-3-1-2-7(6-8)15(19)20/h1-6,9-12H,(H,19,20)/t9-,10-,11-,12+/m0/s1 |
| InChIKey | MUHIAPVVBHYELA-FIQHERPVSA-N |
| XLogP | 0.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|