C16H13NO5 — CID 18389497
3-[(3aR,4R,7R,7aS)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid (PubChem CID 18389497) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-[(3aR,4R,7R,7aS)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aR,4R,7R,7aS)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18389497 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-[(3aR,4R,7R,7aS)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]benzoic acid |
| SMILES | C[C@]12C=C[C@@H](O1)[C@@H]1C(=O)N(c3cccc(C(=O)O)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H13NO5/c1-16-6-5-10(22-16)11-12(16)14(19)17(13(11)18)9-4-2-3-8(7-9)15(20)21/h2-7,10-12H,1H3,(H,20,21)/t10-,11+,12-,16-/m1/s1 |
| InChIKey | FLJJAJJARNCUPA-AZKPJATDSA-N |
| XLogP | 1.22 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|