C16H12ClNO5 — CID 98198250
methyl 5-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate (PubChem CID 98198250) has the molecular formula C16H12ClNO5 and a molecular weight of 333.73 g/mol. Its IUPAC name is methyl 5-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate.
| Compound Name | methyl 5-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 98198250 |
| Molecular Formula | C16H12ClNO5 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | methyl 5-[(3aS,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3O2)ccc1Cl |
| InChI | InChI=1S/C16H12ClNO5/c1-22-16(21)8-6-7(2-3-9(8)17)18-14(19)12-10-4-5-11(23-10)13(12)15(18)20/h2-6,10-13H,1H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | TUVAKQNFJQZMQW-FDYHWXHSSA-N |
| XLogP | 1.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|