C19H16ClNO4 — CID 2256249
methyl 2-chloro-5-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate (PubChem CID 2256249) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is methyl 2-chloro-5-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
|---|---|
| PubChem CID | 2256249 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | methyl 2-chloro-5-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
| SMILES | COC(=O)c1cc(N2C(=O)[C@@H]3[C@@H]4C=C[C@@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)ccc1Cl |
| InChI | InChI=1S/C19H16ClNO4/c1-25-19(24)13-6-8(2-5-14(13)20)21-17(22)15-9-3-4-10(12-7-11(9)12)16(15)18(21)23/h2-6,9-12,15-16H,7H2,1H3/t9-,10+,11+,12-,15-,16+ |
| InChIKey | JQXZJDFFNQQQHW-OCNXXKCSSA-N |
| XLogP | 2.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|