C17H14ClNO4 — CID 6542278
methyl 2-chloro-5-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 6542278) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is methyl 2-chloro-5-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 6542278 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | methyl 2-chloro-5-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | COC(=O)c1cc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@@H]3C2)ccc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c1-23-17(22)11-7-10(4-5-12(11)18)19-15(20)13-8-2-3-9(6-8)14(13)16(19)21/h2-5,7-9,13-14H,6H2,1H3/t8-,9+,13-,14-/m0/s1 |
| InChIKey | QRRACPRDHXOKQN-WAYYCVMKSA-N |
| XLogP | 2.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|