C19H16ClNO4 — CID 7250774
2-chloro-5-[(1S,2R,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid (PubChem CID 7250774) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-chloro-5-[(1S,2R,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(1S,2R,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
|---|---|
| PubChem CID | 7250774 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-chloro-5-[(1S,2R,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
| SMILES | CC(C)=C1[C@H]2C=C[C@H]1[C@H]1C(=O)N(c3ccc(Cl)c(C(=O)O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H16ClNO4/c1-8(2)14-10-4-5-11(14)16-15(10)17(22)21(18(16)23)9-3-6-13(20)12(7-9)19(24)25/h3-7,10-11,15-16H,1-2H3,(H,24,25)/t10-,11-,15-,16+/m1/s1 |
| InChIKey | MUMUGSSTSUBRAT-WVATUKLVSA-N |
| XLogP | 3.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|