C19H15Cl6NO3 — CID 99726289
(1R,2R,6R,7R)-4-(4-butoxyphenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99726289) has the molecular formula C19H15Cl6NO3 and a molecular weight of 518.05 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-(4-butoxyphenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-(4-butoxyphenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99726289 |
| Molecular Formula | C19H15Cl6NO3 |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 514.92 |
| IUPAC Name | (1R,2R,6R,7R)-4-(4-butoxyphenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCCCOc1ccc(N2C(=O)[C@H]3[C@H](C2=O)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]3(Cl)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H15Cl6NO3/c1-2-3-8-29-10-6-4-9(5-7-10)26-15(27)11-12(16(26)28)18(23)14(21)13(20)17(11,22)19(18,24)25/h4-7,11-12H,2-3,8H2,1H3/t11-,12-,17-,18-/m1/s1 |
| InChIKey | QGSYQFBLWLSBIH-GWIYSAMLSA-N |
| XLogP | 5.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|