C38H38N2O6 — CID 162811627
(6R,8S,12S)-4,10-bis(4-butoxyphenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 162811627) has the molecular formula C38H38N2O6 and a molecular weight of 618.73 g/mol. Its IUPAC name is (6R,8S,12S)-4,10-bis(4-butoxyphenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (6R,8S,12S)-4,10-bis(4-butoxyphenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 162811627 |
| Molecular Formula | C38H38N2O6 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | (6R,8S,12S)-4,10-bis(4-butoxyphenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | CCCCOc1ccc(N2C(=O)C3[C@H](C2=O)C2C=CC3(c3ccccc3)[C@H]3C(=O)N(c4ccc(OCCCC)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C38H38N2O6/c1-3-5-22-45-27-16-12-25(13-17-27)39-34(41)30-29-20-21-38(32(30)36(39)43,24-10-8-7-9-11-24)33-31(29)35(42)40(37(33)44)26-14-18-28(19-15-26)46-23-6-4-2/h7-21,29-33H,3-6,22-23H2,1-2H3/t29?,30-,31+,32+,33?,38?/m0/s1 |
| InChIKey | ZPQZWYOEDCAFHZ-LRWRUKMASA-N |
| XLogP | 6.09 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|