C30H20N4O8 — CID 11946732
(2S,6R,8S,12S)-4,10-bis(4-nitrophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 11946732) has the molecular formula C30H20N4O8 and a molecular weight of 564.51 g/mol. Its IUPAC name is (2S,6R,8S,12S)-4,10-bis(4-nitrophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2S,6R,8S,12S)-4,10-bis(4-nitrophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 11946732 |
| Molecular Formula | C30H20N4O8 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | (2S,6R,8S,12S)-4,10-bis(4-nitrophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C1[C@@H]2C3C=CC(c4ccccc4)([C@H]2C(=O)N1c1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)[C@@H]31 |
| InChI | InChI=1S/C30H20N4O8/c35-26-22-21-14-15-30(16-4-2-1-3-5-16,24(22)28(37)31(26)17-6-10-19(11-7-17)33(39)40)25-23(21)27(36)32(29(25)38)18-8-12-20(13-9-18)34(41)42/h1-15,21-25H/t21?,22-,23+,24-,25-,30?/m1/s1 |
| InChIKey | BGGUXZNYTZCNFD-JUPWTUDRSA-N |
| XLogP | 3.55 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|