C30H19BrN4O8 — CID 3114521
1-(4-bromophenyl)-4,10-bis(4-nitrophenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 3114521) has the molecular formula C30H19BrN4O8 and a molecular weight of 643.41 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4,10-bis(4-nitrophenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | 1-(4-bromophenyl)-4,10-bis(4-nitrophenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 3114521 |
| Molecular Formula | C30H19BrN4O8 |
| Molecular Weight | 643.41 g/mol |
| Exact Mass | 642.04 |
| IUPAC Name | 1-(4-bromophenyl)-4,10-bis(4-nitrophenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C1C2C3C=CC(c4ccc(Br)cc4)(C2C(=O)N1c1ccc([N+](=O)[O-])cc1)C1C(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)C31 |
| InChI | InChI=1S/C30H19BrN4O8/c31-16-3-1-15(2-4-16)30-14-13-21(22-24(30)28(38)32(26(22)36)17-5-9-19(10-6-17)34(40)41)23-25(30)29(39)33(27(23)37)18-7-11-20(12-8-18)35(42)43/h1-14,21-25H |
| InChIKey | VUOZPCYXKGQHQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|