C35H24N4O7 — CID 101479894
6,9,11,14-tetraphenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-5,7,10,13,15-pentone (PubChem CID 101479894) has the molecular formula C35H24N4O7 and a molecular weight of 612.60 g/mol. Its IUPAC name is 6,9,11,14-tetraphenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-5,7,10,13,15-pentone.
| Compound Name | 6,9,11,14-tetraphenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-5,7,10,13,15-pentone |
|---|---|
| PubChem CID | 101479894 |
| Molecular Formula | C35H24N4O7 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 6,9,11,14-tetraphenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-5,7,10,13,15-pentone |
| SMILES | O=C1C2ON3N4OC5C(=O)N(c6ccccc6)C(=O)C5C4(c4ccccc4)C(=O)C3(c3ccccc3)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C35H24N4O7/c40-29-25-27(31(42)36(29)23-17-9-3-10-18-23)45-38-34(25,21-13-5-1-6-14-21)33(44)35(22-15-7-2-8-16-22)26-28(46-39(35)38)32(43)37(30(26)41)24-19-11-4-12-20-24/h1-20,25-28H |
| InChIKey | JBWLQHBKUZXNKB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 116.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|