C26H22N4O6 — CID 98559737
5-[(2R,6R,10S,14S)-3,5,11,13-tetraoxo-4,12-diphenyl-7,9-dioxa-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecan-1-yl]pentanenitrile (PubChem CID 98559737) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is 5-[(2R,6R,10S,14S)-3,5,11,13-tetraoxo-4,12-diphenyl-7,9-dioxa-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecan-1-yl]pentanenitrile.
| Compound Name | 5-[(2R,6R,10S,14S)-3,5,11,13-tetraoxo-4,12-diphenyl-7,9-dioxa-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecan-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 98559737 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 5-[(2R,6R,10S,14S)-3,5,11,13-tetraoxo-4,12-diphenyl-7,9-dioxa-4,8,12-triazatetracyclo[6.6.0.02,6.010,14]tetradecan-1-yl]pentanenitrile |
| SMILES | N#CCCCCC12[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@H]3ON1O[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H22N4O6/c27-15-9-3-8-14-26-18-20(24(33)28(22(18)31)16-10-4-1-5-11-16)35-30(26)36-21-19(26)23(32)29(25(21)34)17-12-6-2-7-13-17/h1-2,4-7,10-13,18-21H,3,8-9,14H2/t18-,19+,20-,21+,26? |
| InChIKey | UPTACKWVJNZJIM-CNNMYXRSSA-N |
| XLogP | 2.12 |
| TPSA | 120.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|