C23H18N4O13 — CID 102313133
trimethyl (4S,8R,9R,11R,16S)-5,7,10,13,15-pentaoxo-14-phenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-6,9,11-tricarboxylate (PubChem CID 102313133) has the molecular formula C23H18N4O13 and a molecular weight of 558.41 g/mol. Its IUPAC name is trimethyl (4S,8R,9R,11R,16S)-5,7,10,13,15-pentaoxo-14-phenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-6,9,11-tricarboxylate.
| Compound Name | trimethyl (4S,8R,9R,11R,16S)-5,7,10,13,15-pentaoxo-14-phenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-6,9,11-tricarboxylate |
|---|---|
| PubChem CID | 102313133 |
| Molecular Formula | C23H18N4O13 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | trimethyl (4S,8R,9R,11R,16S)-5,7,10,13,15-pentaoxo-14-phenyl-3,17-dioxa-1,2,6,14-tetrazapentacyclo[9.6.0.02,9.04,8.012,16]heptadecane-6,9,11-tricarboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2ON3N4O[C@@H]5C(=O)N(c6ccccc6)C(=O)C5[C@]4(C(=O)OC)C(=O)[C@@]3(C(=O)OC)[C@H]2C1=O |
| InChI | InChI=1S/C23H18N4O13/c1-36-19(33)22-10-12(16(30)24(14(10)28)9-7-5-4-6-8-9)39-26(22)27-23(18(22)32,20(34)37-2)11-13(40-27)17(31)25(15(11)29)21(35)38-3/h4-8,10-13H,1-3H3/t10?,11-,12+,13+,22-,23-/m1/s1 |
| InChIKey | DUFIISNJEDGPFL-GTBKRDOKSA-N |
| XLogP | -2.52 |
| TPSA | 195.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|