C17H14N2O5 — CID 10336483
methyl (1S,2R,6R,7R)-3,5,9-trioxo-4-phenyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate (PubChem CID 10336483) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl (1S,2R,6R,7R)-3,5,9-trioxo-4-phenyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate.
| Compound Name | methyl (1S,2R,6R,7R)-3,5,9-trioxo-4-phenyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate |
|---|---|
| PubChem CID | 10336483 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl (1S,2R,6R,7R)-3,5,9-trioxo-4-phenyl-4,8-diazatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate |
| SMILES | COC(=O)[C@]12C=C[C@H](C(=O)N1)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H14N2O5/c1-24-16(23)17-8-7-10(13(20)18-17)11-12(17)15(22)19(14(11)21)9-5-3-2-4-6-9/h2-8,10-12H,1H3,(H,18,20)/t10-,11+,12-,17+/m0/s1 |
| InChIKey | TTZVEXDJZXZVRU-HBGPKNEHSA-N |
| XLogP | 0.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|