C41H27NO7 — CID 99654319
[(1R,2S,6S,7R)-9-benzoyloxy-3,5,10-trioxo-1,4,7-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-8-yl] benzoate (PubChem CID 99654319) has the molecular formula C41H27NO7 and a molecular weight of 645.67 g/mol. Its IUPAC name is [(1R,2S,6S,7R)-9-benzoyloxy-3,5,10-trioxo-1,4,7-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-8-yl] benzoate.
| Compound Name | [(1R,2S,6S,7R)-9-benzoyloxy-3,5,10-trioxo-1,4,7-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-8-yl] benzoate |
|---|---|
| PubChem CID | 99654319 |
| Molecular Formula | C41H27NO7 |
| Molecular Weight | 645.67 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | [(1R,2S,6S,7R)-9-benzoyloxy-3,5,10-trioxo-1,4,7-triphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-8-yl] benzoate |
| SMILES | O=C(OC1=C(OC(=O)c2ccccc2)[C@@]2(c3ccccc3)C(=O)[C@@]1(c1ccccc1)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C41H27NO7/c43-35-31-32(36(44)42(35)30-24-14-5-15-25-30)41(29-22-12-4-13-23-29)34(49-38(46)27-18-8-2-9-19-27)33(48-37(45)26-16-6-1-7-17-26)40(31,39(41)47)28-20-10-3-11-21-28/h1-25,31-32H/t31-,32-,40+,41+/m1/s1 |
| InChIKey | RGEJQBNRKFNAHW-XGCUQYKWSA-N |
| XLogP | 6.19 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|