C26H21N3O4 — CID 139237500
(3S,3'aR,6'aS)-5'-(4-ethylphenyl)-2'-phenylspiro[1H-indole-3,3'-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole]-2,4',6'-trione (PubChem CID 139237500) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is (3S,3'aR,6'aS)-5'-(4-ethylphenyl)-2'-phenylspiro[1H-indole-3,3'-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole]-2,4',6'-trione.
| Compound Name | (3S,3'aR,6'aS)-5'-(4-ethylphenyl)-2'-phenylspiro[1H-indole-3,3'-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole]-2,4',6'-trione |
|---|---|
| PubChem CID | 139237500 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (3S,3'aR,6'aS)-5'-(4-ethylphenyl)-2'-phenylspiro[1H-indole-3,3'-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole]-2,4',6'-trione |
| SMILES | CCc1ccc(N2C(=O)[C@H]3ON(c4ccccc4)[C@@]4(C(=O)Nc5ccccc54)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H21N3O4/c1-2-16-12-14-17(15-13-16)28-23(30)21-22(24(28)31)33-29(18-8-4-3-5-9-18)26(21)19-10-6-7-11-20(19)27-25(26)32/h3-15,21-22H,2H2,1H3,(H,27,32)/t21-,22+,26-/m1/s1 |
| InChIKey | BAHKOLLCGOVLKT-TVZXLZGTSA-N |
| XLogP | 3.41 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|