C22H19NO3 — CID 7030838
(3aR,4R,7S,7aR)-4,7-dimethyl-2-(4-phenylphenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 7030838) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-4,7-dimethyl-2-(4-phenylphenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aR)-4,7-dimethyl-2-(4-phenylphenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 7030838 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (3aR,4R,7S,7aR)-4,7-dimethyl-2-(4-phenylphenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12C=C[C@](C)(O1)[C@@H]1C(=O)N(c3ccc(-c4ccccc4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H19NO3/c1-21-12-13-22(2,26-21)18-17(21)19(24)23(20(18)25)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-13,17-18H,1-2H3/t17-,18-,21-,22+/m0/s1 |
| InChIKey | YKDFOSOLYUBJDP-YHDSQAASSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|