C27H25NO3 — CID 132967262
(1S,2R,3S,7R,8R,12S)-1,12-dimethyl-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadeca-9,13-diene-4,6-dione (PubChem CID 132967262) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is (1S,2R,3S,7R,8R,12S)-1,12-dimethyl-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadeca-9,13-diene-4,6-dione.
| Compound Name | (1S,2R,3S,7R,8R,12S)-1,12-dimethyl-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadeca-9,13-diene-4,6-dione |
|---|---|
| PubChem CID | 132967262 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1S,2R,3S,7R,8R,12S)-1,12-dimethyl-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadeca-9,13-diene-4,6-dione |
| SMILES | C[C@]12C=C[C@](C)(O1)[C@H]1C(=C[C@@H](c3ccccc3)[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]31)C2 |
| InChI | InChI=1S/C27H25NO3/c1-26-13-14-27(2,31-26)23-18(16-26)15-20(17-9-5-3-6-10-17)21-22(23)25(30)28(24(21)29)19-11-7-4-8-12-19/h3-15,20-23H,16H2,1-2H3/t20-,21+,22+,23-,26+,27-/m0/s1 |
| InChIKey | MISBPFMBYRJMBZ-WUNZNTDPSA-N |
| XLogP | 4.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|