C31H29NO4 — CID 100988259
(3aR,4R,7R,9R,9aR,9bS)-7-methoxy-7-methyl-2,4,9-triphenyl-3a,4,8,9,9a,9b-hexahydropyrano[3,2-e]isoindole-1,3-dione (PubChem CID 100988259) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is (3aR,4R,7R,9R,9aR,9bS)-7-methoxy-7-methyl-2,4,9-triphenyl-3a,4,8,9,9a,9b-hexahydropyrano[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,9R,9aR,9bS)-7-methoxy-7-methyl-2,4,9-triphenyl-3a,4,8,9,9a,9b-hexahydropyrano[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 100988259 |
| Molecular Formula | C31H29NO4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (3aR,4R,7R,9R,9aR,9bS)-7-methoxy-7-methyl-2,4,9-triphenyl-3a,4,8,9,9a,9b-hexahydropyrano[3,2-e]isoindole-1,3-dione |
| SMILES | CO[C@@]1(C)C[C@@H](c2ccccc2)[C@H]2C(=C[C@@H](c3ccccc3)[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]32)O1 |
| InChI | InChI=1S/C31H29NO4/c1-31(35-2)19-24(21-14-8-4-9-15-21)26-25(36-31)18-23(20-12-6-3-7-13-20)27-28(26)30(34)32(29(27)33)22-16-10-5-11-17-22/h3-18,23-24,26-28H,19H2,1-2H3/t23-,24-,26-,27+,28-,31+/m0/s1 |
| InChIKey | SEICUJBRUFWYTE-QKZKZHJJSA-N |
| XLogP | 5.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|