C17H13NO6 — CID 12595119
methyl 3,5,9-trioxo-4-phenyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate (PubChem CID 12595119) has the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. Its IUPAC name is methyl 3,5,9-trioxo-4-phenyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate.
| Compound Name | methyl 3,5,9-trioxo-4-phenyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
|---|---|
| PubChem CID | 12595119 |
| Molecular Formula | C17H13NO6 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 3,5,9-trioxo-4-phenyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
| SMILES | COC(=O)C1=CC2C(=O)OC1C1C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C17H13NO6/c1-23-16(21)10-7-9-11-12(13(10)24-17(9)22)15(20)18(14(11)19)8-5-3-2-4-6-8/h2-7,9,11-13H,1H3 |
| InChIKey | CZBBCFHLILSXJH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|