C25H20N2O6 — CID 6580584
methyl 4-[(3R,3aS,6aS)-3-(2-hydroxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 6580584) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is methyl 4-[(3R,3aS,6aS)-3-(2-hydroxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | methyl 4-[(3R,3aS,6aS)-3-(2-hydroxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 6580584 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | methyl 4-[(3R,3aS,6aS)-3-(2-hydroxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](ON(c4ccccc4)[C@H]3c3ccccc3O)C2=O)cc1 |
| InChI | InChI=1S/C25H20N2O6/c1-32-25(31)15-11-13-16(14-12-15)26-23(29)20-21(18-9-5-6-10-19(18)28)27(33-22(20)24(26)30)17-7-3-2-4-8-17/h2-14,20-22,28H,1H3/t20-,21-,22-/m0/s1 |
| InChIKey | GNMSAOWUQQBDTJ-FKBYEOEOSA-N |
| XLogP | 3.23 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|