C25H18Cl2N2O5 — CID 51575967
methyl 4-[(3S,3aR,6aS)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate (PubChem CID 51575967) has the molecular formula C25H18Cl2N2O5 and a molecular weight of 497.33 g/mol. Its IUPAC name is methyl 4-[(3S,3aR,6aS)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate.
| Compound Name | methyl 4-[(3S,3aR,6aS)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 51575967 |
| Molecular Formula | C25H18Cl2N2O5 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | methyl 4-[(3S,3aR,6aS)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@H]3C(=O)N(c4ccc(Cl)c(Cl)c4)C(=O)[C@H]3ON2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O5/c1-33-25(32)15-9-7-14(8-10-15)21-20-22(34-29(21)16-5-3-2-4-6-16)24(31)28(23(20)30)17-11-12-18(26)19(27)13-17/h2-13,20-22H,1H3/t20-,21-,22+/m1/s1 |
| InChIKey | LAPBPRQUNKXYNB-VSKRKVRLSA-N |
| XLogP | 4.83 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|