C31H22Cl2N2O6 — CID 100824421
[4-[(3S,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate (PubChem CID 100824421) has the molecular formula C31H22Cl2N2O6 and a molecular weight of 589.43 g/mol. Its IUPAC name is [4-[(3S,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[(3S,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 100824421 |
| Molecular Formula | C31H22Cl2N2O6 |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | [4-[(3S,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc([C@@H]2[C@@H]3C(=O)N(c4ccc(Cl)c(Cl)c4)C(=O)[C@@H]3ON2c2ccccc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H22Cl2N2O6/c1-39-25-16-19(12-15-24(25)40-31(38)18-8-4-2-5-9-18)27-26-28(41-35(27)20-10-6-3-7-11-20)30(37)34(29(26)36)21-13-14-22(32)23(33)17-21/h2-17,26-28H,1H3/t26-,27+,28+/m0/s1 |
| InChIKey | DEWWSCGSCXXTIC-UPRLRBBYSA-N |
| XLogP | 6.27 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|