C30H26N4O6 — CID 98361120
[4-[(3S,3aR,6aR)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2,5-dimethylpyrazole-3-carboxylate (PubChem CID 98361120) has the molecular formula C30H26N4O6 and a molecular weight of 538.56 g/mol. Its IUPAC name is [4-[(3S,3aR,6aR)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2,5-dimethylpyrazole-3-carboxylate.
| Compound Name | [4-[(3S,3aR,6aR)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2,5-dimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 98361120 |
| Molecular Formula | C30H26N4O6 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | [4-[(3S,3aR,6aR)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2,5-dimethylpyrazole-3-carboxylate |
| SMILES | COc1cc([C@@H]2[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3ON2c2ccccc2)ccc1OC(=O)c1cc(C)nn1C |
| InChI | InChI=1S/C30H26N4O6/c1-18-16-22(32(2)31-18)30(37)39-23-15-14-19(17-24(23)38-3)26-25-27(40-34(26)21-12-8-5-9-13-21)29(36)33(28(25)35)20-10-6-4-7-11-20/h4-17,25-27H,1-3H3/t25-,26-,27-/m1/s1 |
| InChIKey | GDRJJHSRUREXAI-ZONZVBGPSA-N |
| XLogP | 4.01 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|