C35H26N2O6 — CID 98326731
[4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate (PubChem CID 98326731) has the molecular formula C35H26N2O6 and a molecular weight of 570.60 g/mol. Its IUPAC name is [4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 98326731 |
| Molecular Formula | C35H26N2O6 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] benzoate |
| SMILES | COc1cc([C@@H]2[C@@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3ON2c2ccccc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H26N2O6/c1-41-29-21-24(19-20-28(29)42-35(40)23-12-4-2-5-13-23)31-30-32(43-37(31)25-15-6-3-7-16-25)34(39)36(33(30)38)27-18-10-14-22-11-8-9-17-26(22)27/h2-21,30-32H,1H3/t30-,31+,32-/m0/s1 |
| InChIKey | QRFDFRRFGPLMDF-QAXCHELISA-N |
| XLogP | 6.12 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|