C32H25N3O8 — CID 4977151
[2-methoxy-4-[5-(2-methylphenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 4977151) has the molecular formula C32H25N3O8 and a molecular weight of 579.57 g/mol. Its IUPAC name is [2-methoxy-4-[5-(2-methylphenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[5-(2-methylphenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 4977151 |
| Molecular Formula | C32H25N3O8 |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | [2-methoxy-4-[5-(2-methylphenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | COc1cc(C2C3C(=O)N(c4ccccc4C)C(=O)C3ON2c2cccc([N+](=O)[O-])c2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H25N3O8/c1-19-9-6-7-14-24(19)33-30(36)27-28(34(43-29(27)31(33)37)22-12-8-13-23(18-22)35(39)40)21-15-16-25(26(17-21)41-2)42-32(38)20-10-4-3-5-11-20/h3-18,27-29H,1-2H3 |
| InChIKey | BSYIHBQFXRTASG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|