C34H23N3O7 — CID 98382158
[4-[(3R,3aR,6aS)-5-naphthalen-1-yl-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 98382158) has the molecular formula C34H23N3O7 and a molecular weight of 585.57 g/mol. Its IUPAC name is [4-[(3R,3aR,6aS)-5-naphthalen-1-yl-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [4-[(3R,3aR,6aS)-5-naphthalen-1-yl-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 98382158 |
| Molecular Formula | C34H23N3O7 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | [4-[(3R,3aR,6aS)-5-naphthalen-1-yl-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc([C@H]2[C@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3ON2c2cccc([N+](=O)[O-])c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H23N3O7/c38-32-29-30(22-16-18-26(19-17-22)43-34(40)23-9-2-1-3-10-23)36(24-12-7-13-25(20-24)37(41)42)44-31(29)33(39)35(32)28-15-6-11-21-8-4-5-14-27(21)28/h1-20,29-31H/t29-,30+,31+/m1/s1 |
| InChIKey | BWYFQTHFDLOHJB-AYQJTBPPSA-N |
| XLogP | 6.02 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|