C29H22BrN3O7 — CID 100832288
(3S,3aS,6aR)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 100832288) has the molecular formula C29H22BrN3O7 and a molecular weight of 604.41 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aR)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 100832288 |
| Molecular Formula | C29H22BrN3O7 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 603.06 |
| IUPAC Name | (3S,3aS,6aR)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cc([C@@H]2[C@@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@@H]3ON2c2cccc([N+](=O)[O-])c2)cc(Br)c1O |
| InChI | InChI=1S/C29H22BrN3O7/c1-2-39-23-14-17(13-21(30)26(23)34)25-24-27(40-32(25)18-9-6-10-19(15-18)33(37)38)29(36)31(28(24)35)22-12-5-8-16-7-3-4-11-20(16)22/h3-15,24-25,27,34H,2H2,1H3/t24-,25+,27+/m0/s1 |
| InChIKey | GRKVKYDAHGSZLD-ZWEKWIFMSA-N |
| XLogP | 5.67 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|