C25H20BrFN2O5 — CID 98179055
(3R,3aR,6aS)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-(2-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98179055) has the molecular formula C25H20BrFN2O5 and a molecular weight of 527.35 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-(2-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aR,6aS)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-(2-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98179055 |
| Molecular Formula | C25H20BrFN2O5 |
| Molecular Weight | 527.35 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | (3R,3aR,6aS)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-5-(2-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cc([C@H]2[C@H]3C(=O)N(c4ccccc4F)C(=O)[C@H]3ON2c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C25H20BrFN2O5/c1-2-33-19-13-14(12-16(26)22(19)30)21-20-23(34-29(21)15-8-4-3-5-9-15)25(32)28(24(20)31)18-11-7-6-10-17(18)27/h3-13,20-21,23,30H,2H2,1H3/t20-,21+,23+/m1/s1 |
| InChIKey | YSJOAQTYWZPHOE-GIWBLDEGSA-N |
| XLogP | 4.74 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|