C25H21BrN2O6 — CID 98185040
(3R,3aR,6aS)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-(2-methoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98185040) has the molecular formula C25H21BrN2O6 and a molecular weight of 525.36 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-(2-methoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aR,6aS)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-(2-methoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98185040 |
| Molecular Formula | C25H21BrN2O6 |
| Molecular Weight | 525.36 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | (3R,3aR,6aS)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-(2-methoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccccc1N1C(=O)[C@H]2[C@H](ON(c3ccccc3)[C@H]2c2cc(Br)c(O)c(OC)c2)C1=O |
| InChI | InChI=1S/C25H21BrN2O6/c1-32-18-11-7-6-10-17(18)27-24(30)20-21(14-12-16(26)22(29)19(13-14)33-2)28(34-23(20)25(27)31)15-8-4-3-5-9-15/h3-13,20-21,23,29H,1-2H3/t20-,21+,23+/m1/s1 |
| InChIKey | ZUNIUNSVSVVHHU-GIWBLDEGSA-N |
| XLogP | 4.22 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|