C29H24N4O5 — CID 98172230
(3S,3aS,6aS)-3-[4-(dimethylamino)phenyl]-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98172230) has the molecular formula C29H24N4O5 and a molecular weight of 508.53 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-[4-(dimethylamino)phenyl]-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aS)-3-[4-(dimethylamino)phenyl]-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98172230 |
| Molecular Formula | C29H24N4O5 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (3S,3aS,6aS)-3-[4-(dimethylamino)phenyl]-5-naphthalen-1-yl-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CN(C)c1ccc([C@@H]2[C@@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3ON2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H24N4O5/c1-30(2)20-15-13-19(14-16-20)26-25-27(38-32(26)21-9-6-10-22(17-21)33(36)37)29(35)31(28(25)34)24-12-5-8-18-7-3-4-11-23(18)24/h3-17,25-27H,1-2H3/t25-,26+,27-/m0/s1 |
| InChIKey | LUDNBEDYZWKYCU-VJGNERBWSA-N |
| XLogP | 4.87 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|