C30H20N4O9 — CID 98380818
[4-[(3S,3aS,6aS)-2,5-bis(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 98380818) has the molecular formula C30H20N4O9 and a molecular weight of 580.51 g/mol. Its IUPAC name is [4-[(3S,3aS,6aS)-2,5-bis(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [4-[(3S,3aS,6aS)-2,5-bis(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 98380818 |
| Molecular Formula | C30H20N4O9 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | [4-[(3S,3aS,6aS)-2,5-bis(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc([C@@H]2[C@@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@H]3ON2c2ccc([N+](=O)[O-])cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H20N4O9/c35-28-25-26(18-6-16-24(17-7-18)42-30(37)19-4-2-1-3-5-19)32(21-10-14-23(15-11-21)34(40)41)43-27(25)29(36)31(28)20-8-12-22(13-9-20)33(38)39/h1-17,25-27H/t25-,26+,27-/m0/s1 |
| InChIKey | HUFMLFFVGLRPHU-VJGNERBWSA-N |
| XLogP | 4.77 |
| TPSA | 162.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|