C32H26N2O5 — CID 98172166
[4-[(3S,3aS,6aS)-5-(4-ethylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 98172166) has the molecular formula C32H26N2O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is [4-[(3S,3aS,6aS)-5-(4-ethylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [4-[(3S,3aS,6aS)-5-(4-ethylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 98172166 |
| Molecular Formula | C32H26N2O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [4-[(3S,3aS,6aS)-5-(4-ethylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | CCc1ccc(N2C(=O)[C@@H]3[C@H](ON(c4ccccc4)[C@@H]3c3ccc(OC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H26N2O5/c1-2-21-13-17-24(18-14-21)33-30(35)27-28(34(39-29(27)31(33)36)25-11-7-4-8-12-25)22-15-19-26(20-16-22)38-32(37)23-9-5-3-6-10-23/h3-20,27-29H,2H2,1H3/t27-,28+,29-/m0/s1 |
| InChIKey | PHZGVBIVILFIRP-NHKHRBQYSA-N |
| XLogP | 5.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|