C30H21FN2O5 — CID 6586271
[4-[(3R,3aS,6aS)-5-(2-fluorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 6586271) has the molecular formula C30H21FN2O5 and a molecular weight of 508.51 g/mol. Its IUPAC name is [4-[(3R,3aS,6aS)-5-(2-fluorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [4-[(3R,3aS,6aS)-5-(2-fluorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 6586271 |
| Molecular Formula | C30H21FN2O5 |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | [4-[(3R,3aS,6aS)-5-(2-fluorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc([C@H]2[C@@H]3C(=O)N(c4ccccc4F)C(=O)[C@H]3ON2c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H21FN2O5/c31-23-13-7-8-14-24(23)32-28(34)25-26(33(38-27(25)29(32)35)21-11-5-2-6-12-21)19-15-17-22(18-16-19)37-30(36)20-9-3-1-4-10-20/h1-18,25-27H/t25-,26-,27-/m0/s1 |
| InChIKey | AVFPRVAOUSFFCL-QKDODKLFSA-N |
| XLogP | 5.10 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|