C26H21N3O7 — CID 23989444
ethyl 4-[3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 23989444) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is ethyl 4-[3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 4-[3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 23989444 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | ethyl 4-[3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3ON(c4ccccc4)C(c4ccc([N+](=O)[O-])cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C26H21N3O7/c1-2-35-26(32)17-10-12-18(13-11-17)27-24(30)21-22(16-8-14-20(15-9-16)29(33)34)28(36-23(21)25(27)31)19-6-4-3-5-7-19/h3-15,21-23H,2H2,1H3 |
| InChIKey | VQLNMDHNGHOZFN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|