C25H19N3O7 — CID 70682486
4-[(3R,3aS,6aR)-2-(4-methylphenyl)-3-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid (PubChem CID 70682486) has the molecular formula C25H19N3O7 and a molecular weight of 473.44 g/mol. Its IUPAC name is 4-[(3R,3aS,6aR)-2-(4-methylphenyl)-3-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid.
| Compound Name | 4-[(3R,3aS,6aR)-2-(4-methylphenyl)-3-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 70682486 |
| Molecular Formula | C25H19N3O7 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[(3R,3aS,6aR)-2-(4-methylphenyl)-3-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
| SMILES | Cc1ccc(N2O[C@H]3C(=O)N(c4ccc(C(=O)O)cc4)C(=O)[C@H]3[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H19N3O7/c1-14-2-8-18(9-3-14)27-21(15-4-12-19(13-5-15)28(33)34)20-22(35-27)24(30)26(23(20)29)17-10-6-16(7-11-17)25(31)32/h2-13,20-22H,1H3,(H,31,32)/t20-,21-,22+/m0/s1 |
| InChIKey | LJRHRQJKHBSLBJ-FDFHNCONSA-N |
| XLogP | 3.65 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|