C24H17N3O7 — CID 100822698
4-[(3R,3aS,6aR)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid (PubChem CID 100822698) has the molecular formula C24H17N3O7 and a molecular weight of 459.41 g/mol. Its IUPAC name is 4-[(3R,3aS,6aR)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid.
| Compound Name | 4-[(3R,3aS,6aR)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 100822698 |
| Molecular Formula | C24H17N3O7 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-[(3R,3aS,6aR)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)[C@@H]3[C@@H](ON(c4ccccc4)[C@H]3c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C24H17N3O7/c28-22-19-20(15-5-4-8-18(13-15)27(32)33)26(17-6-2-1-3-7-17)34-21(19)23(29)25(22)16-11-9-14(10-12-16)24(30)31/h1-13,19-21H,(H,30,31)/t19-,20-,21+/m0/s1 |
| InChIKey | NATCCOPVGBHQHE-PCCBWWKXSA-N |
| XLogP | 3.34 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|