C25H21N3O7S — CID 98137487
methyl 2-[(3R,3aR,6aS)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 98137487) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is methyl 2-[(3R,3aR,6aS)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3R,3aR,6aS)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 98137487 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | methyl 2-[(3R,3aR,6aS)-3-(3-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@H]3[C@H](ON(c4ccccc4)[C@H]3c3cccc([N+](=O)[O-])c3)C2=O)sc(C)c1C |
| InChI | InChI=1S/C25H21N3O7S/c1-13-14(2)36-24(18(13)25(31)34-3)26-22(29)19-20(15-8-7-11-17(12-15)28(32)33)27(35-21(19)23(26)30)16-9-5-4-6-10-16/h4-12,19-21H,1-3H3/t19-,20+,21+/m1/s1 |
| InChIKey | QAVGYZMLNOINKU-HKBOAZHASA-N |
| XLogP | 4.11 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|