C27H23N3O7S — CID 98137483
methyl 2-[(3R,3aR,6aS)-3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98137483) has the molecular formula C27H23N3O7S and a molecular weight of 533.56 g/mol. Its IUPAC name is methyl 2-[(3R,3aR,6aS)-3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3R,3aR,6aS)-3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98137483 |
| Molecular Formula | C27H23N3O7S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | methyl 2-[(3R,3aR,6aS)-3-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@H]3[C@H](ON(c4ccccc4)[C@H]3c3ccc([N+](=O)[O-])cc3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C27H23N3O7S/c1-36-27(33)20-18-9-5-6-10-19(18)38-26(20)28-24(31)21-22(15-11-13-17(14-12-15)30(34)35)29(37-23(21)25(28)32)16-7-3-2-4-8-16/h2-4,7-8,11-14,21-23H,5-6,9-10H2,1H3/t21-,22+,23+/m1/s1 |
| InChIKey | FIYGEGLBLLMZJD-VJBWXMMDSA-N |
| XLogP | 4.37 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|