C28H26N2O5S — CID 1188626
methyl 2-[(3R,3aS,6aR)-2-(2-methylphenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 1188626) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is methyl 2-[(3R,3aS,6aR)-2-(2-methylphenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3R,3aS,6aR)-2-(2-methylphenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1188626 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | methyl 2-[(3R,3aS,6aR)-2-(2-methylphenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@@H](ON(c4ccccc4C)[C@H]3c3ccccc3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C28H26N2O5S/c1-16-10-6-8-14-19(16)30-23(17-11-4-3-5-12-17)22-24(35-30)26(32)29(25(22)31)27-21(28(33)34-2)18-13-7-9-15-20(18)36-27/h3-6,8,10-12,14,22-24H,7,9,13,15H2,1-2H3/t22-,23-,24+/m0/s1 |
| InChIKey | SZKOLGDUOUMZTP-KMDXXIMOSA-N |
| XLogP | 4.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|