C18H19NO5S — CID 98273735
methyl 2-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98273735) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 2-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98273735 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 2-[(3aR,4S,7S,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2CC[C@@H]3O2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H19NO5S/c1-23-18(22)12-8-4-2-3-5-11(8)25-17(12)19-15(20)13-9-6-7-10(24-9)14(13)16(19)21/h9-10,13-14H,2-7H2,1H3/t9-,10-,13-,14+/m0/s1 |
| InChIKey | HKGFAMQWXBOYHV-TXFQPVFDSA-N |
| XLogP | 2.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|