C13H11NO4S — CID 7456257
methyl 2-(2,5-dioxopyrrol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 7456257) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is methyl 2-(2,5-dioxopyrrol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-(2,5-dioxopyrrol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7456257 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | methyl 2-(2,5-dioxopyrrol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)C=CC2=O)sc2c1CCC2 |
| InChI | InChI=1S/C13H11NO4S/c1-18-13(17)11-7-3-2-4-8(7)19-12(11)14-9(15)5-6-10(14)16/h5-6H,2-4H2,1H3 |
| InChIKey | LOFISIOQFTYBLT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|