C27H27N3O3S — CID 1250420
methyl 2-[(4S)-2-amino-3-cyano-5-oxo-4-phenyl-4,6,7,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 1250420) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is methyl 2-[(4S)-2-amino-3-cyano-5-oxo-4-phenyl-4,6,7,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4S)-2-amino-3-cyano-5-oxo-4-phenyl-4,6,7,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1250420 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl 2-[(4S)-2-amino-3-cyano-5-oxo-4-phenyl-4,6,7,8-tetrahydroquinolin-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(N)=C(C#N)[C@H](c3ccccc3)C3=C2CCCC3=O)sc2c1CCCCC2 |
| InChI | InChI=1S/C27H27N3O3S/c1-33-27(32)23-17-11-6-3-7-14-21(17)34-26(23)30-19-12-8-13-20(31)24(19)22(18(15-28)25(30)29)16-9-4-2-5-10-16/h2,4-5,9-10,22H,3,6-8,11-14,29H2,1H3/t22-/m0/s1 |
| InChIKey | OKXYOTFASQVHJC-QFIPXVFZSA-N |
| XLogP | 5.11 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |