C27H28N4O3S — CID 41200664
methyl 2-[(4R)-2-amino-3-cyano-7,7-dimethyl-5-oxo-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 41200664) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is methyl 2-[(4R)-2-amino-3-cyano-7,7-dimethyl-5-oxo-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(4R)-2-amino-3-cyano-7,7-dimethyl-5-oxo-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 41200664 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | methyl 2-[(4R)-2-amino-3-cyano-7,7-dimethyl-5-oxo-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(N)=C(C#N)[C@@H](c3cccnc3)C3=C2CC(C)(C)CC3=O)sc2c1CCCC2 |
| InChI | InChI=1S/C27H28N4O3S/c1-27(2)11-18-23(19(32)12-27)21(15-7-6-10-30-14-15)17(13-28)24(29)31(18)25-22(26(33)34-3)16-8-4-5-9-20(16)35-25/h6-7,10,14,21H,4-5,8-9,11-12,29H2,1-3H3/t21-/m1/s1 |
| InChIKey | LBFLCPVHPLLUQD-OAQYLSRUSA-N |
| XLogP | 4.75 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |