C25H19N3O7 — CID 51578291
methyl 4-[(3R,3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate (PubChem CID 51578291) has the molecular formula C25H19N3O7 and a molecular weight of 473.44 g/mol. Its IUPAC name is methyl 4-[(3R,3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate.
| Compound Name | methyl 4-[(3R,3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 51578291 |
| Molecular Formula | C25H19N3O7 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl 4-[(3R,3aR,6aS)-5-(4-nitrophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@H]3ON2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19N3O7/c1-34-25(31)16-9-7-15(8-10-16)21-20-22(35-27(21)18-5-3-2-4-6-18)24(30)26(23(20)29)17-11-13-19(14-12-17)28(32)33/h2-14,20-22H,1H3/t20-,21+,22+/m1/s1 |
| InChIKey | HRZYQCWAWVJHII-FSSWDIPSSA-N |
| XLogP | 3.43 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|