C26H22N2O5S — CID 98390416
methyl 4-[(3S,3aR,6aR)-3-(4-methylsulfanylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 98390416) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is methyl 4-[(3S,3aR,6aR)-3-(4-methylsulfanylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | methyl 4-[(3S,3aR,6aR)-3-(4-methylsulfanylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 98390416 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | methyl 4-[(3S,3aR,6aR)-3-(4-methylsulfanylphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H](c4ccc(SC)cc4)N(c4ccccc4)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O5S/c1-32-26(31)17-8-12-18(13-9-17)27-24(29)21-22(16-10-14-20(34-2)15-11-16)28(33-23(21)25(27)30)19-6-4-3-5-7-19/h3-15,21-23H,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | NMRMDEFPEGIYCU-DNVJHFABSA-N |
| XLogP | 4.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|