C31H23N3O8 — CID 4872787
[2-methoxy-4-[2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate (PubChem CID 4872787) has the molecular formula C31H23N3O8 and a molecular weight of 565.54 g/mol. Its IUPAC name is [2-methoxy-4-[2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 4872787 |
| Molecular Formula | C31H23N3O8 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [2-methoxy-4-[2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzoate |
| SMILES | COc1cc(C2C3C(=O)N(c4ccccc4)C(=O)C3ON2c2cccc([N+](=O)[O-])c2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H23N3O8/c1-40-25-17-20(15-16-24(25)41-31(37)19-9-4-2-5-10-19)27-26-28(30(36)32(29(26)35)21-11-6-3-7-12-21)42-33(27)22-13-8-14-23(18-22)34(38)39/h2-18,26-28H,1H3 |
| InChIKey | JJWRMUDJDIYGKZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|