C31H22BrFN2O6 — CID 98325230
[4-[(3R,3aS,6aS)-5-(4-bromophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 98325230) has the molecular formula C31H22BrFN2O6 and a molecular weight of 617.43 g/mol. Its IUPAC name is [4-[(3R,3aS,6aS)-5-(4-bromophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(3R,3aS,6aS)-5-(4-bromophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 98325230 |
| Molecular Formula | C31H22BrFN2O6 |
| Molecular Weight | 617.43 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | [4-[(3R,3aS,6aS)-5-(4-bromophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc([C@H]2[C@@H]3C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]3ON2c2ccccc2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H22BrFN2O6/c1-39-25-17-19(9-16-24(25)40-31(38)18-7-12-21(33)13-8-18)27-26-28(41-35(27)23-5-3-2-4-6-23)30(37)34(29(26)36)22-14-10-20(32)11-15-22/h2-17,26-28H,1H3/t26-,27-,28-/m0/s1 |
| InChIKey | QBPQPBWTXZKNEU-KCHLEUMXSA-N |
| XLogP | 5.87 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|