C33H27FN2O7 — CID 98715147
[4-[(3S,3aS,6aR)-5-(4-ethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 98715147) has the molecular formula C33H27FN2O7 and a molecular weight of 582.58 g/mol. Its IUPAC name is [4-[(3S,3aS,6aR)-5-(4-ethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(3S,3aS,6aR)-5-(4-ethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 98715147 |
| Molecular Formula | C33H27FN2O7 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | [4-[(3S,3aS,6aR)-5-(4-ethoxyphenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | CCOc1ccc(N2C(=O)[C@H]3[C@@H](c4ccc(OC(=O)c5ccc(F)cc5)c(OC)c4)N(c4ccccc4)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H27FN2O7/c1-3-41-25-16-14-23(15-17-25)35-31(37)28-29(36(43-30(28)32(35)38)24-7-5-4-6-8-24)21-11-18-26(27(19-21)40-2)42-33(39)20-9-12-22(34)13-10-20/h4-19,28-30H,3H2,1-2H3/t28-,29+,30+/m0/s1 |
| InChIKey | GWKJFVPKSTWKQX-FRXPANAUSA-N |
| XLogP | 5.50 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|